C24H33N5O3 — CID 69317900
N-[(2S)-1-[2-(2,3-dihydroindol-1-yl)ethylamino]-1,8-dioxodecan-2-yl]-1H-pyrazole-4-carboxamide (PubChem CID 69317900) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[(2S)-1-[2-(2,3-dihydroindol-1-yl)ethylamino]-1,8-dioxodecan-2-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(2S)-1-[2-(2,3-dihydroindol-1-yl)ethylamino]-1,8-dioxodecan-2-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 69317900 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-[(2S)-1-[2-(2,3-dihydroindol-1-yl)ethylamino]-1,8-dioxodecan-2-yl]-1H-pyrazole-4-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)c1cn[nH]c1)C(=O)NCCN1CCc2ccccc21 |
| InChI | InChI=1S/C24H33N5O3/c1-2-20(30)9-4-3-5-10-21(28-23(31)19-16-26-27-17-19)24(32)25-13-15-29-14-12-18-8-6-7-11-22(18)29/h6-8,11,16-17,21H,2-5,9-10,12-15H2,1H3,(H,25,32)(H,26,27)(H,28,31)/t21-/m0/s1 |
| InChIKey | RSTKSQYYZMACLI-NRFANRHFSA-N |
| XLogP | 2.62 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|