C24H29N5O3 — CID 69318526
N-[(2S)-1,8-dioxo-1-(quinolin-3-ylmethylamino)decan-2-yl]-1H-imidazole-2-carboxamide (PubChem CID 69318526) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-(quinolin-3-ylmethylamino)decan-2-yl]-1H-imidazole-2-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-(quinolin-3-ylmethylamino)decan-2-yl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 69318526 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-(quinolin-3-ylmethylamino)decan-2-yl]-1H-imidazole-2-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)c1ncc[nH]1)C(=O)NCc1cnc2ccccc2c1 |
| InChI | InChI=1S/C24H29N5O3/c1-2-19(30)9-4-3-5-11-21(29-24(32)22-25-12-13-26-22)23(31)28-16-17-14-18-8-6-7-10-20(18)27-15-17/h6-8,10,12-15,21H,2-5,9,11,16H2,1H3,(H,25,26)(H,28,31)(H,29,32)/t21-/m0/s1 |
| InChIKey | HZPZWBXMVHXFBV-NRFANRHFSA-N |
| XLogP | 3.30 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|