C22H31Cl2N3O3 — CID 69319223
N-[(2S)-1-(3,5-dichloroanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-4-carboxamide (PubChem CID 69319223) has the molecular formula C22H31Cl2N3O3 and a molecular weight of 456.41 g/mol. Its IUPAC name is N-[(2S)-1-(3,5-dichloroanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-(3,5-dichloroanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 69319223 |
| Molecular Formula | C22H31Cl2N3O3 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[(2S)-1-(3,5-dichloroanilino)-1,8-dioxononan-2-yl]-1-methylpiperidine-4-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1CCN(C)CC1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H31Cl2N3O3/c1-15(28)6-4-3-5-7-20(26-21(29)16-8-10-27(2)11-9-16)22(30)25-19-13-17(23)12-18(24)14-19/h12-14,16,20H,3-11H2,1-2H3,(H,25,30)(H,26,29)/t20-/m0/s1 |
| InChIKey | VPKWPBASSWTJJC-FQEVSTJZSA-N |
| XLogP | 4.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|