C6H7NO — CID 6931994
(1R,4R)-2-azabicyclo[2.2.1]hept-5-en-3-one (PubChem CID 6931994) has the molecular formula C6H7NO and a molecular weight of 109.13 g/mol. Its IUPAC name is (1R,4R)-2-azabicyclo[2.2.1]hept-5-en-3-one.
| Compound Name | (1R,4R)-2-azabicyclo[2.2.1]hept-5-en-3-one |
|---|---|
| PubChem CID | 6931994 |
| Molecular Formula | C6H7NO |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.05 |
| IUPAC Name | (1R,4R)-2-azabicyclo[2.2.1]hept-5-en-3-one |
| SMILES | C1[C@@H]2C=C[C@@H]1NC2=O |
| InChI | InChI=1S/C6H7NO/c8-6-4-1-2-5(3-4)7-6/h1-2,4-5H,3H2,(H,7,8)/t4-,5-/m0/s1 |
| InChIKey | DDUFYKNOXPZZIW-WHFBIAKZSA-N |
| XLogP | 0.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 162 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|