C26H33Cl2FN4O6 — CID 69320160
2-(4,5-dichloro-2-fluorophenyl)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazoline-4,6-diamine (PubChem CID 69320160) has the molecular formula C26H33Cl2FN4O6 and a molecular weight of 587.48 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-fluorophenyl)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazoline-4,6-diamine.
| Compound Name | 2-(4,5-dichloro-2-fluorophenyl)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 69320160 |
| Molecular Formula | C26H33Cl2FN4O6 |
| Molecular Weight | 587.48 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 2-(4,5-dichloro-2-fluorophenyl)-7-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]quinazoline-4,6-diamine |
| SMILES | CCOCCOCCOCCOCCOCCOc1cc2nc(-c3cc(Cl)c(Cl)cc3F)nc(N)c2cc1N |
| InChI | InChI=1S/C26H33Cl2FN4O6/c1-2-34-3-4-35-5-6-36-7-8-37-9-10-38-11-12-39-24-16-23-18(14-22(24)30)25(31)33-26(32-23)17-13-19(27)20(28)15-21(17)29/h13-16H,2-12,30H2,1H3,(H2,31,32,33) |
| InChIKey | YKBVSVSYHAIBRY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|