About azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate
azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate (PubChem CID 69320358) has the molecular formula C22H27N3O3
and a molecular weight of 381.48 g/mol. Its IUPAC name is azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate.
Molecular Properties
| Compound Name | azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate |
| PubChem CID | 69320358 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate |
| SMILES | N.O=C(OCc1ccccc1)N1CCCC2(CC1)CC(c1ccccc1)=NO2 |
| InChI | InChI=1S/C22H24N2O3.H3N/c25-21(26-17-18-8-3-1-4-9-18)24-14-7-12-22(13-15-24)16-20(23-27-22)19-10-5-2-6-11-19;/h1-6,8-11H,7,12-17H2;1H3 |
| InChIKey | SGAVMYVYVPYCOF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate?
The IUPAC name of azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate (CID 69320358) is azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate.
What is the SMILES notation for azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate?
The canonical SMILES for azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate is N.O=C(OCc1ccccc1)N1CCCC2(CC1)CC(c1ccccc1)=NO2.
What is the InChIKey of azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate?
The InChIKey is SGAVMYVYVPYCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3.H3N/c25-21(26-17-18-8-3-1-4-9-18)24-14-7-12-22(13-15-24)16-20(23-27-22)19-10-5-2-6-11-19;/h1-6,8-11H,7,12-17H2;1H3.
What are the key properties of azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate?
azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate has a molecular weight of 381.48 g/mol, XLogP of 4.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-ene-9-carboxylate is sourced from PubChem (CID 69320358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).