About (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium
(2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium (PubChem CID 6932043) has the molecular formula C8H9N2S2+
and a molecular weight of 197.31 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium.
Molecular Properties
| Compound Name | (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium |
| PubChem CID | 6932043 |
| Molecular Formula | C8H9N2S2+ |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium |
| SMILES | [NH3+]Cc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H8N2S2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4,9H2/p+1 |
| InChIKey | VZBJIPJKJKKWPH-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium?
The IUPAC name of (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium (CID 6932043) is (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium.
What is the SMILES notation for (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium?
The canonical SMILES for (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium is [NH3+]Cc1csc(-c2cccs2)n1.
What is the InChIKey of (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium?
The InChIKey is VZBJIPJKJKKWPH-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H8N2S2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4,9H2/p+1.
What are the key properties of (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium?
(2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium has a molecular weight of 197.31 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-thiophen-2-yl-1,3-thiazol-4-yl)methylazanium is sourced from PubChem (CID 6932043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).