C17H14NO4- — CID 6932061
(2R)-1-phenylmethoxycarbonyl-2,3-dihydroindole-2-carboxylate (PubChem CID 6932061) has the molecular formula C17H14NO4- and a molecular weight of 296.30 g/mol. Its IUPAC name is (2R)-1-phenylmethoxycarbonyl-2,3-dihydroindole-2-carboxylate.
| Compound Name | (2R)-1-phenylmethoxycarbonyl-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 6932061 |
| Molecular Formula | C17H14NO4- |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (2R)-1-phenylmethoxycarbonyl-2,3-dihydroindole-2-carboxylate |
| SMILES | O=C([O-])[C@H]1Cc2ccccc2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15NO4/c19-16(20)15-10-13-8-4-5-9-14(13)18(15)17(21)22-11-12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,19,20)/p-1/t15-/m1/s1 |
| InChIKey | BSOYWTITVKXHLM-OAHLLOKOSA-M |
| XLogP | 1.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |