C26H32N4O5S — CID 69320662
2-[4-[[methyl-[(E)-4-[(2,4,6-trimethylphenyl)sulfonylmethylamino]but-2-enoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid (PubChem CID 69320662) has the molecular formula C26H32N4O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-[4-[[methyl-[(E)-4-[(2,4,6-trimethylphenyl)sulfonylmethylamino]but-2-enoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid.
| Compound Name | 2-[4-[[methyl-[(E)-4-[(2,4,6-trimethylphenyl)sulfonylmethylamino]but-2-enoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid |
|---|---|
| PubChem CID | 69320662 |
| Molecular Formula | C26H32N4O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 2-[4-[[methyl-[(E)-4-[(2,4,6-trimethylphenyl)sulfonylmethylamino]but-2-enoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)CNC/C=C/C(=O)N(C)Cc2ccc(C3=NCCN3C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C26H32N4O5S/c1-18-14-19(2)24(20(3)15-18)36(34,35)17-27-11-5-6-23(31)29(4)16-21-7-9-22(10-8-21)25-28-12-13-30(25)26(32)33/h5-10,14-15,27H,11-13,16-17H2,1-4H3,(H,32,33)/b6-5+ |
| InChIKey | OTPVWZSPKHXDSW-AATRIKPKSA-N |
| XLogP | 2.89 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|