About 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium
3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium (PubChem CID 69320804) has the molecular formula C9H14NS+
and a molecular weight of 168.29 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium.
Molecular Properties
| Compound Name | 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium |
| PubChem CID | 69320804 |
| Molecular Formula | C9H14NS+ |
| Molecular Weight | 168.29 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium |
| SMILES | Cc1scc[n+]1CC1CCC1 |
| InChI | InChI=1S/C9H14NS/c1-8-10(5-6-11-8)7-9-3-2-4-9/h5-6,9H,2-4,7H2,1H3/q+1 |
| InChIKey | VKPYDIWGAMTPMH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium?
The IUPAC name of 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium (CID 69320804) is 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium.
What is the SMILES notation for 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium?
The canonical SMILES for 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium is Cc1scc[n+]1CC1CCC1.
What is the InChIKey of 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium?
The InChIKey is VKPYDIWGAMTPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14NS/c1-8-10(5-6-11-8)7-9-3-2-4-9/h5-6,9H,2-4,7H2,1H3/q+1.
What are the key properties of 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium?
3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium has a molecular weight of 168.29 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclobutylmethyl)-2-methyl-1,3-thiazol-3-ium is sourced from PubChem (CID 69320804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).