About (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one
(1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one (PubChem CID 6932162) has the molecular formula C7H8Cl2O2
and a molecular weight of 195.04 g/mol. Its IUPAC name is (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one.
Molecular Properties
| Compound Name | (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one |
| PubChem CID | 6932162 |
| Molecular Formula | C7H8Cl2O2 |
| Molecular Weight | 195.04 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one |
| SMILES | O=C1[C@@H]2OCCC[C@@H]2C1(Cl)Cl |
| InChI | InChI=1S/C7H8Cl2O2/c8-7(9)4-2-1-3-11-5(4)6(7)10/h4-5H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | DFTZRAHFJDVLTI-CRCLSJGQSA-N |
| XLogP | 1.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.04 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one?
The IUPAC name of (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one (CID 6932162) is (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one.
What is the SMILES notation for (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one?
The canonical SMILES for (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one is O=C1[C@@H]2OCCC[C@@H]2C1(Cl)Cl.
What is the InChIKey of (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one?
The InChIKey is DFTZRAHFJDVLTI-CRCLSJGQSA-N. The full InChI is InChI=1S/C7H8Cl2O2/c8-7(9)4-2-1-3-11-5(4)6(7)10/h4-5H,1-3H2/t4-,5+/m0/s1.
What are the key properties of (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one?
(1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one has a molecular weight of 195.04 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-7,7-dichloro-2-oxabicyclo[4.2.0]octan-8-one is sourced from PubChem (CID 6932162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).