C34H39F2N3O3 — CID 69321822
[3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 3-[bis(prop-2-enyl)carbamoyl]-5-methylbenzoate (PubChem CID 69321822) has the molecular formula C34H39F2N3O3 and a molecular weight of 575.70 g/mol. Its IUPAC name is [3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 3-[bis(prop-2-enyl)carbamoyl]-5-methylbenzoate.
| Compound Name | [3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 3-[bis(prop-2-enyl)carbamoyl]-5-methylbenzoate |
|---|---|
| PubChem CID | 69321822 |
| Molecular Formula | C34H39F2N3O3 |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | [3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 3-[bis(prop-2-enyl)carbamoyl]-5-methylbenzoate |
| SMILES | C=CCN(CC=C)C(=O)c1cc(C)cc(C(=O)OC(CNCc2cccc(CC)c2)C(N)Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C34H39F2N3O3/c1-5-11-39(12-6-2)33(40)27-13-23(4)14-28(19-27)34(41)42-32(22-38-21-25-10-8-9-24(7-3)15-25)31(37)18-26-16-29(35)20-30(36)17-26/h5-6,8-10,13-17,19-20,31-32,38H,1-2,7,11-12,18,21-22,37H2,3-4H3 |
| InChIKey | BLQZXHLLGHQJPY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|