About 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol
3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol (PubChem CID 69322834) has the molecular formula C17H15FOS
and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol.
Molecular Properties
| Compound Name | 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol |
| PubChem CID | 69322834 |
| Molecular Formula | C17H15FOS |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol |
| SMILES | C=CCC1c2ccccc2Sc2ccc(F)cc2C1O |
| InChI | InChI=1S/C17H15FOS/c1-2-5-13-12-6-3-4-7-15(12)20-16-9-8-11(18)10-14(16)17(13)19/h2-4,6-10,13,17,19H,1,5H2 |
| InChIKey | RBODSPWVTFOEQI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
The IUPAC name of 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol (CID 69322834) is 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol.
What is the SMILES notation for 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
The canonical SMILES for 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol is C=CCC1c2ccccc2Sc2ccc(F)cc2C1O.
What is the InChIKey of 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
The InChIKey is RBODSPWVTFOEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FOS/c1-2-5-13-12-6-3-4-7-15(12)20-16-9-8-11(18)10-14(16)17(13)19/h2-4,6-10,13,17,19H,1,5H2.
What are the key properties of 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol has a molecular weight of 286.37 g/mol, XLogP of 4.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-prop-2-enyl-5,6-dihydrobenzo[b][1]benzothiepin-5-ol is sourced from PubChem (CID 69322834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).