C16H24O8 — CID 69322953
[(2S,3R,4S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]methyl acetate (PubChem CID 69322953) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is [(2S,3R,4S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69322953 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [(2S,3R,4S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]methyl acetate |
| SMILES | C=CCCCOC1O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O8/c1-5-6-7-8-20-16-15(23-12(4)19)14(22-11(3)18)13(24-16)9-21-10(2)17/h5,13-16H,1,6-9H2,2-4H3/t13-,14+,15-,16?/m0/s1 |
| InChIKey | WMYAYBZDWAGPAU-QGPPMGRFSA-N |
| XLogP | 1.12 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|