About hydron;pyrido[1,2-a]pyrimidin-4-one;chloride
hydron;pyrido[1,2-a]pyrimidin-4-one;chloride (PubChem CID 69323143) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is hydron;pyrido[1,2-a]pyrimidin-4-one;chloride.
Molecular Properties
| Compound Name | hydron;pyrido[1,2-a]pyrimidin-4-one;chloride |
| PubChem CID | 69323143 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | hydron;pyrido[1,2-a]pyrimidin-4-one;chloride |
| SMILES | O=c1ccnc2ccccn12.[Cl-].[H+] |
| InChI | InChI=1S/C8H6N2O.ClH/c11-8-4-5-9-7-3-1-2-6-10(7)8;/h1-6H;1H |
| InChIKey | FMIHQBGKVOHFJK-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;pyrido[1,2-a]pyrimidin-4-one;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pyrido[1,2-a]pyrimidin-4-one;chloride?
The IUPAC name of hydron;pyrido[1,2-a]pyrimidin-4-one;chloride (CID 69323143) is hydron;pyrido[1,2-a]pyrimidin-4-one;chloride.
What is the SMILES notation for hydron;pyrido[1,2-a]pyrimidin-4-one;chloride?
The canonical SMILES for hydron;pyrido[1,2-a]pyrimidin-4-one;chloride is O=c1ccnc2ccccn12.[Cl-].[H+].
What is the InChIKey of hydron;pyrido[1,2-a]pyrimidin-4-one;chloride?
The InChIKey is FMIHQBGKVOHFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.ClH/c11-8-4-5-9-7-3-1-2-6-10(7)8;/h1-6H;1H.
What are the key properties of hydron;pyrido[1,2-a]pyrimidin-4-one;chloride?
hydron;pyrido[1,2-a]pyrimidin-4-one;chloride has a molecular weight of 182.61 g/mol, XLogP of -2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pyrido[1,2-a]pyrimidin-4-one;chloride is sourced from PubChem (CID 69323143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).