C30H43F2N3O3 — CID 69323294
[3-amino-4-(3,5-difluorophenyl)-1-(pentylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate (PubChem CID 69323294) has the molecular formula C30H43F2N3O3 and a molecular weight of 531.69 g/mol. Its IUPAC name is [3-amino-4-(3,5-difluorophenyl)-1-(pentylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate.
| Compound Name | [3-amino-4-(3,5-difluorophenyl)-1-(pentylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate |
|---|---|
| PubChem CID | 69323294 |
| Molecular Formula | C30H43F2N3O3 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | [3-amino-4-(3,5-difluorophenyl)-1-(pentylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate |
| SMILES | CCCCCNCC(OC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1)C(N)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C30H43F2N3O3/c1-5-8-9-10-34-20-28(27(33)17-22-15-25(31)19-26(32)16-22)38-30(37)24-14-21(4)13-23(18-24)29(36)35(11-6-2)12-7-3/h13-16,18-19,27-28,34H,5-12,17,20,33H2,1-4H3 |
| InChIKey | PMWUDKUPGXUKQN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|