About 1,1-diethoxyethane;thiophene
1,1-diethoxyethane;thiophene (PubChem CID 69323416) has the molecular formula C10H18O2S
and a molecular weight of 202.32 g/mol. Its IUPAC name is 1,1-diethoxyethane;thiophene.
Molecular Properties
| Compound Name | 1,1-diethoxyethane;thiophene |
| PubChem CID | 69323416 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,1-diethoxyethane;thiophene |
| SMILES | CCOC(C)OCC.c1ccsc1 |
| InChI | InChI=1S/C6H14O2.C4H4S/c1-4-7-6(3)8-5-2;1-2-4-5-3-1/h6H,4-5H2,1-3H3;1-4H |
| InChIKey | MNNAVBSKLQFFLF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxyethane;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxyethane;thiophene?
The IUPAC name of 1,1-diethoxyethane;thiophene (CID 69323416) is 1,1-diethoxyethane;thiophene.
What is the SMILES notation for 1,1-diethoxyethane;thiophene?
The canonical SMILES for 1,1-diethoxyethane;thiophene is CCOC(C)OCC.c1ccsc1.
What is the InChIKey of 1,1-diethoxyethane;thiophene?
The InChIKey is MNNAVBSKLQFFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C4H4S/c1-4-7-6(3)8-5-2;1-2-4-5-3-1/h6H,4-5H2,1-3H3;1-4H.
What are the key properties of 1,1-diethoxyethane;thiophene?
1,1-diethoxyethane;thiophene has a molecular weight of 202.32 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxyethane;thiophene is sourced from PubChem (CID 69323416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).