C21H32N4O3 — CID 69323674
N-[(2S)-1,8-dioxo-1-(pyridin-3-ylamino)nonan-2-yl]-1-methylpiperidine-2-carboxamide (PubChem CID 69323674) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-(pyridin-3-ylamino)nonan-2-yl]-1-methylpiperidine-2-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-(pyridin-3-ylamino)nonan-2-yl]-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 69323674 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-(pyridin-3-ylamino)nonan-2-yl]-1-methylpiperidine-2-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1CCCCN1C)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C21H32N4O3/c1-16(26)9-4-3-5-11-18(20(27)23-17-10-8-13-22-15-17)24-21(28)19-12-6-7-14-25(19)2/h8,10,13,15,18-19H,3-7,9,11-12,14H2,1-2H3,(H,23,27)(H,24,28)/t18-,19?/m0/s1 |
| InChIKey | BLTNEOUGDQZKNY-OYKVQYDMSA-N |
| XLogP | 2.53 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|