About (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione
(1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 6932423) has the molecular formula C6H4O4
and a molecular weight of 140.09 g/mol. Its IUPAC name is (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
Molecular Properties
| Compound Name | (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| PubChem CID | 6932423 |
| Molecular Formula | C6H4O4 |
| Molecular Weight | 140.09 g/mol |
| Exact Mass | 140.01 |
| IUPAC Name | (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | O=C1C=C(O)C(=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C6H4O4/c7-2-1-3(8)5-6(10-5)4(2)9/h1,5-7H/t5-,6+/m1/s1 |
| InChIKey | HWTYHISMBRULSZ-RITPCOANSA-N |
| XLogP | -0.65 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.09 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The IUPAC name of (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (CID 6932423) is (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
What is the SMILES notation for (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The canonical SMILES for (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione is O=C1C=C(O)C(=O)[C@@H]2O[C@H]12.
What is the InChIKey of (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The InChIKey is HWTYHISMBRULSZ-RITPCOANSA-N. The full InChI is InChI=1S/C6H4O4/c7-2-1-3(8)5-6(10-5)4(2)9/h1,5-7H/t5-,6+/m1/s1.
What are the key properties of (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
(1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione has a molecular weight of 140.09 g/mol, XLogP of -0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-3-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione is sourced from PubChem (CID 6932423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).