C10H7F3N2O3 — CID 69324439
pyrido[1,2-a]pyrimidin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 69324439) has the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. Its IUPAC name is pyrido[1,2-a]pyrimidin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | pyrido[1,2-a]pyrimidin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69324439 |
| Molecular Formula | C10H7F3N2O3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | pyrido[1,2-a]pyrimidin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=c1ccnc2ccccn12 |
| InChI | InChI=1S/C8H6N2O.C2HF3O2/c11-8-4-5-9-7-3-1-2-6-10(7)8;3-2(4,5)1(6)7/h1-6H;(H,6,7) |
| InChIKey | YSZVPXDBDOEJRS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |