C11H13NO2 — CID 6932463
(2R)-2,7-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 6932463) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (2R)-2,7-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | (2R)-2,7-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 6932463 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2R)-2,7-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | Cc1ccc2c(c1)NC(=O)C[C@@H](C)O2 |
| InChI | InChI=1S/C11H13NO2/c1-7-3-4-10-9(5-7)12-11(13)6-8(2)14-10/h3-5,8H,6H2,1-2H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | PMOXBZWAOHVZOL-MRVPVSSYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |