C19H20N4O — CID 69324802
(4aS)-8-(2-methoxyanilino)-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole-6-carbonitrile (PubChem CID 69324802) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is (4aS)-8-(2-methoxyanilino)-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole-6-carbonitrile.
| Compound Name | (4aS)-8-(2-methoxyanilino)-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole-6-carbonitrile |
|---|---|
| PubChem CID | 69324802 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (4aS)-8-(2-methoxyanilino)-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole-6-carbonitrile |
| SMILES | COc1ccccc1Nc1cc(C#N)c2c(c1)C1CNCC[C@@H]1N2 |
| InChI | InChI=1S/C19H20N4O/c1-24-18-5-3-2-4-17(18)22-13-8-12(10-20)19-14(9-13)15-11-21-7-6-16(15)23-19/h2-5,8-9,15-16,21-23H,6-7,11H2,1H3/t15?,16-/m0/s1 |
| InChIKey | OLJJHZUOYHIRLK-LYKKTTPLSA-N |
| XLogP | 3.18 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|