C10H14N2O2 — CID 6932481
(3R,9R)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione (PubChem CID 6932481) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (3R,9R)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione.
| Compound Name | (3R,9R)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
|---|---|
| PubChem CID | 6932481 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (3R,9R)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
| SMILES | O=C1[C@H]2CCCN2C(=O)[C@H]2CCCN12 |
| InChI | InChI=1S/C10H14N2O2/c13-9-7-3-1-5-11(7)10(14)8-4-2-6-12(8)9/h7-8H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | BKASXWPLSXFART-HTQZYQBOSA-N |
| XLogP | -0.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |