About 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione
1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 69325069) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione |
| PubChem CID | 69325069 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)n(C)c(=O)c2c(C)csc21 |
| InChI | InChI=1S/C10H12N2O2S/c1-4-12-9-7(6(2)5-15-9)8(13)11(3)10(12)14/h5H,4H2,1-3H3 |
| InChIKey | BFFCWHAHOGKNHU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione?
The IUPAC name of 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione (CID 69325069) is 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione.
What is the SMILES notation for 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione?
The canonical SMILES for 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione is CCn1c(=O)n(C)c(=O)c2c(C)csc21.
What is the InChIKey of 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione?
The InChIKey is BFFCWHAHOGKNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-4-12-9-7(6(2)5-15-9)8(13)11(3)10(12)14/h5H,4H2,1-3H3.
What are the key properties of 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione?
1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione has a molecular weight of 224.28 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione is sourced from PubChem (CID 69325069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).