C20H21F3N2O2 — CID 69325344
(4aS)-8-(2-methoxyphenoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 69325344) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is (4aS)-8-(2-methoxyphenoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS)-8-(2-methoxyphenoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 69325344 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (4aS)-8-(2-methoxyphenoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | COc1ccccc1Oc1cc2c(c(C(F)(F)F)c1)N(C)[C@H]1CCNCC21 |
| InChI | InChI=1S/C20H21F3N2O2/c1-25-16-7-8-24-11-14(16)13-9-12(10-15(19(13)25)20(21,22)23)27-18-6-4-3-5-17(18)26-2/h3-6,9-10,14,16,24H,7-8,11H2,1-2H3/t14?,16-/m0/s1 |
| InChIKey | JCEKHONCGNGWFP-WMCAAGNKSA-N |
| XLogP | 4.40 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |