C33H41N3OS — CID 69325515
N-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]-N-[[4-(methylsulfanylmethoxy)phenyl]methyl]butan-1-amine (PubChem CID 69325515) has the molecular formula C33H41N3OS and a molecular weight of 527.78 g/mol. Its IUPAC name is N-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]-N-[[4-(methylsulfanylmethoxy)phenyl]methyl]butan-1-amine.
| Compound Name | N-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]-N-[[4-(methylsulfanylmethoxy)phenyl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 69325515 |
| Molecular Formula | C33H41N3OS |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | N-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]-N-[[4-(methylsulfanylmethoxy)phenyl]methyl]butan-1-amine |
| SMILES | CCCCN(Cc1ccc(OCSC)cc1)Cc1c(-c2ccccc2)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C33H41N3OS/c1-4-6-22-35(24-27-18-20-30(21-19-27)37-26-38-3)25-31-32(28-14-10-8-11-15-28)34-33(36(31)23-7-5-2)29-16-12-9-13-17-29/h8-21H,4-7,22-26H2,1-3H3 |
| InChIKey | KLNJSKPMYZZTTF-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|