About 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine
3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine (PubChem CID 69325564) has the molecular formula C14H13N3
and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine |
| PubChem CID | 69325564 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine |
| SMILES | C1=NCCC=C1C1=NC=c2ccccc2=NC1 |
| InChI | InChI=1S/C14H13N3/c1-2-6-13-12(4-1)9-16-14(10-17-13)11-5-3-7-15-8-11/h1-2,4-6,8-9H,3,7,10H2 |
| InChIKey | YPAFHAMBBGLGOC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine?
The IUPAC name of 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine (CID 69325564) is 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine.
What is the SMILES notation for 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine?
The canonical SMILES for 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine is C1=NCCC=C1C1=NC=c2ccccc2=NC1.
What is the InChIKey of 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine?
The InChIKey is YPAFHAMBBGLGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3/c1-2-6-13-12(4-1)9-16-14(10-17-13)11-5-3-7-15-8-11/h1-2,4-6,8-9H,3,7,10H2.
What are the key properties of 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine?
3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine has a molecular weight of 223.28 g/mol, XLogP of 0.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydropyridin-5-yl)-2H-1,4-benzodiazepine is sourced from PubChem (CID 69325564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).