About formaldehyde;1-prop-2-enylnaphthalene
formaldehyde;1-prop-2-enylnaphthalene (PubChem CID 69326534) has the molecular formula C14H14O
and a molecular weight of 198.26 g/mol. Its IUPAC name is formaldehyde;1-prop-2-enylnaphthalene.
Molecular Properties
| Compound Name | formaldehyde;1-prop-2-enylnaphthalene |
| PubChem CID | 69326534 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | formaldehyde;1-prop-2-enylnaphthalene |
| SMILES | C=CCc1cccc2ccccc12.C=O |
| InChI | InChI=1S/C13H12.CH2O/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12;1-2/h2-5,7-10H,1,6H2;1H2 |
| InChIKey | LZVLOPNFKKJZDE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;1-prop-2-enylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;1-prop-2-enylnaphthalene?
The IUPAC name of formaldehyde;1-prop-2-enylnaphthalene (CID 69326534) is formaldehyde;1-prop-2-enylnaphthalene.
What is the SMILES notation for formaldehyde;1-prop-2-enylnaphthalene?
The canonical SMILES for formaldehyde;1-prop-2-enylnaphthalene is C=CCc1cccc2ccccc12.C=O.
What is the InChIKey of formaldehyde;1-prop-2-enylnaphthalene?
The InChIKey is LZVLOPNFKKJZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.CH2O/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12;1-2/h2-5,7-10H,1,6H2;1H2.
What are the key properties of formaldehyde;1-prop-2-enylnaphthalene?
formaldehyde;1-prop-2-enylnaphthalene has a molecular weight of 198.26 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;1-prop-2-enylnaphthalene is sourced from PubChem (CID 69326534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).