About methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate
methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate (PubChem CID 69326649) has the molecular formula C33H40N4O2
and a molecular weight of 524.71 g/mol. Its IUPAC name is methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate |
| PubChem CID | 69326649 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate |
| SMILES | CCCCC(NCc1ccc(C(=O)OC)c(N)c1)c1c(-c2ccccc2)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C33H40N4O2/c1-4-6-18-29(35-23-24-19-20-27(28(34)22-24)33(38)39-3)31-30(25-14-10-8-11-15-25)36-32(37(31)21-7-5-2)26-16-12-9-13-17-26/h8-17,19-20,22,29,35H,4-7,18,21,23,34H2,1-3H3 |
| InChIKey | BJIGFLZZJVALSO-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate?
The IUPAC name of methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate (CID 69326649) is methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate.
What is the SMILES notation for methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate?
The canonical SMILES for methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate is CCCCC(NCc1ccc(C(=O)OC)c(N)c1)c1c(-c2ccccc2)nc(-c2ccccc2)n1CCCC.
What is the InChIKey of methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate?
The InChIKey is BJIGFLZZJVALSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H40N4O2/c1-4-6-18-29(35-23-24-19-20-27(28(34)22-24)33(38)39-3)31-30(25-14-10-8-11-15-25)36-32(37(31)21-7-5-2)26-16-12-9-13-17-26/h8-17,19-20,22,29,35H,4-7,18,21,23,34H2,1-3H3.
What are the key properties of methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate?
methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate has a molecular weight of 524.71 g/mol, XLogP of 7.41, 13 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-[[1-(3-butyl-2,5-diphenylimidazol-4-yl)pentylamino]methyl]benzoate is sourced from PubChem (CID 69326649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).