C18H17N3O — CID 6932699
(3aS,9bR)-3,4-dimethyl-5-oxido-1-phenyl-3a,9b-dihydropyrazolo[4,3-c]quinolin-5-ium (PubChem CID 6932699) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is (3aS,9bR)-3,4-dimethyl-5-oxido-1-phenyl-3a,9b-dihydropyrazolo[4,3-c]quinolin-5-ium.
| Compound Name | (3aS,9bR)-3,4-dimethyl-5-oxido-1-phenyl-3a,9b-dihydropyrazolo[4,3-c]quinolin-5-ium |
|---|---|
| PubChem CID | 6932699 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (3aS,9bR)-3,4-dimethyl-5-oxido-1-phenyl-3a,9b-dihydropyrazolo[4,3-c]quinolin-5-ium |
| SMILES | CC1=NN(c2ccccc2)[C@H]2c3ccccc3[N+]([O-])=C(C)[C@H]12 |
| InChI | InChI=1S/C18H17N3O/c1-12-17-13(2)21(22)16-11-7-6-10-15(16)18(17)20(19-12)14-8-4-3-5-9-14/h3-11,17-18H,1-2H3/t17-,18-/m0/s1 |
| InChIKey | BWMMOELXELJKRE-ROUUACIJSA-N |
| XLogP | 3.86 |
| TPSA | 41.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|