C27H28FN7O — CID 69327283
1-[4-(aminomethyl)cyclohexyl]-3-[(2S)-2-fluoro-2-phenoxy-1H-quinolin-7-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 69327283) has the molecular formula C27H28FN7O and a molecular weight of 485.57 g/mol. Its IUPAC name is 1-[4-(aminomethyl)cyclohexyl]-3-[(2S)-2-fluoro-2-phenoxy-1H-quinolin-7-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[4-(aminomethyl)cyclohexyl]-3-[(2S)-2-fluoro-2-phenoxy-1H-quinolin-7-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 69327283 |
| Molecular Formula | C27H28FN7O |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 1-[4-(aminomethyl)cyclohexyl]-3-[(2S)-2-fluoro-2-phenoxy-1H-quinolin-7-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | NCC1CCC(n2nc(-c3ccc4c(c3)N[C@](F)(Oc3ccccc3)C=C4)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C27H28FN7O/c28-27(36-21-4-2-1-3-5-21)13-12-18-8-9-19(14-22(18)33-27)24-23-25(30)31-16-32-26(23)35(34-24)20-10-6-17(15-29)7-11-20/h1-5,8-9,12-14,16-17,20,33H,6-7,10-11,15,29H2,(H2,30,31,32)/t17?,20?,27-/m0/s1 |
| InChIKey | CRXJJQBDYZXDLD-GJYYTEAASA-N |
| XLogP | 4.91 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|