About dioctyl(diphenyl)azanium bromide
dioctyl(diphenyl)azanium bromide (PubChem CID 69327421) has the molecular formula C28H44BrN
and a molecular weight of 474.57 g/mol. Its IUPAC name is dioctyl(diphenyl)azanium bromide.
Molecular Properties
| Compound Name | dioctyl(diphenyl)azanium bromide |
| PubChem CID | 69327421 |
| Molecular Formula | C28H44BrN |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | dioctyl(diphenyl)azanium bromide |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C28H44N.BrH/c1-3-5-7-9-11-19-25-29(27-21-15-13-16-22-27,28-23-17-14-18-24-28)26-20-12-10-8-6-4-2;/h13-18,21-24H,3-12,19-20,25-26H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PQYHBRQTLIVDOR-UHFFFAOYSA-M |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioctyl(diphenyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyl(diphenyl)azanium bromide?
The IUPAC name of dioctyl(diphenyl)azanium bromide (CID 69327421) is dioctyl(diphenyl)azanium bromide.
What is the SMILES notation for dioctyl(diphenyl)azanium bromide?
The canonical SMILES for dioctyl(diphenyl)azanium bromide is CCCCCCCC[N+](CCCCCCCC)(c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of dioctyl(diphenyl)azanium bromide?
The InChIKey is PQYHBRQTLIVDOR-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H44N.BrH/c1-3-5-7-9-11-19-25-29(27-21-15-13-16-22-27,28-23-17-14-18-24-28)26-20-12-10-8-6-4-2;/h13-18,21-24H,3-12,19-20,25-26H2,1-2H3;1H/q+1;/p-1.
What are the key properties of dioctyl(diphenyl)azanium bromide?
dioctyl(diphenyl)azanium bromide has a molecular weight of 474.57 g/mol, XLogP of 6.05, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyl(diphenyl)azanium bromide is sourced from PubChem (CID 69327421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).