C15H25N9 — CID 69327473
N'-[bis(1,2,4-triazol-1-yl)methyl]-N-prop-2-enyl-N'-[2-(prop-2-enylamino)ethyl]ethane-1,2-diamine (PubChem CID 69327473) has the molecular formula C15H25N9 and a molecular weight of 331.43 g/mol. Its IUPAC name is N'-[bis(1,2,4-triazol-1-yl)methyl]-N-prop-2-enyl-N'-[2-(prop-2-enylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[bis(1,2,4-triazol-1-yl)methyl]-N-prop-2-enyl-N'-[2-(prop-2-enylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 69327473 |
| Molecular Formula | C15H25N9 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | N'-[bis(1,2,4-triazol-1-yl)methyl]-N-prop-2-enyl-N'-[2-(prop-2-enylamino)ethyl]ethane-1,2-diamine |
| SMILES | C=CCNCCN(CCNCC=C)C(n1cncn1)n1cncn1 |
| InChI | InChI=1S/C15H25N9/c1-3-5-16-7-9-22(10-8-17-6-4-2)15(23-13-18-11-20-23)24-14-19-12-21-24/h3-4,11-17H,1-2,5-10H2 |
| InChIKey | CELLLUBODPIMPG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|