C17H25N — CID 69327479
4,5,5,6-tetrakis(prop-2-enyl)-3,4-dihydro-2H-pyridine (PubChem CID 69327479) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 4,5,5,6-tetrakis(prop-2-enyl)-3,4-dihydro-2H-pyridine.
| Compound Name | 4,5,5,6-tetrakis(prop-2-enyl)-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 69327479 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 4,5,5,6-tetrakis(prop-2-enyl)-3,4-dihydro-2H-pyridine |
| SMILES | C=CCC1=NCCC(CC=C)C1(CC=C)CC=C |
| InChI | InChI=1S/C17H25N/c1-5-9-15-11-14-18-16(10-6-2)17(15,12-7-3)13-8-4/h5-8,15H,1-4,9-14H2 |
| InChIKey | FJHIBXPYIXFVAB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|