C9H19ClN+ — CID 6932750
4-chloro-2,2,6,6-tetramethylpiperidin-1-ium (PubChem CID 6932750) has the molecular formula C9H19ClN+ and a molecular weight of 176.71 g/mol. Its IUPAC name is 4-chloro-2,2,6,6-tetramethylpiperidin-1-ium.
| Compound Name | 4-chloro-2,2,6,6-tetramethylpiperidin-1-ium |
|---|---|
| PubChem CID | 6932750 |
| Molecular Formula | C9H19ClN+ |
| Molecular Weight | 176.71 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-chloro-2,2,6,6-tetramethylpiperidin-1-ium |
| SMILES | CC1(C)CC(Cl)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C9H18ClN/c1-8(2)5-7(10)6-9(3,4)11-8/h7,11H,5-6H2,1-4H3/p+1 |
| InChIKey | XWKOFHVPNLKHOK-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|