About CID 69327778
CID 69327778 (PubChem CID 69327778) has the molecular formula C7H7BFO3
and a molecular weight of 168.94 g/mol.
Molecular Properties
| Compound Name | CID 69327778 |
| PubChem CID | 69327778 |
| Molecular Formula | C7H7BFO3 |
| Molecular Weight | 168.94 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | — |
| SMILES | Fc1cc2ccc1OC2.O[B]O |
| InChI | InChI=1S/C7H5FO.BH2O2/c8-6-3-5-1-2-7(6)9-4-5;2-1-3/h1-3H,4H2;2-3H |
| InChIKey | AFQRNUWCAAQUBY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.94 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69327778 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69327778?
The IUPAC name of CID 69327778 (CID 69327778) is not available.
What is the SMILES notation for CID 69327778?
The canonical SMILES for CID 69327778 is Fc1cc2ccc1OC2.O[B]O.
What is the InChIKey of CID 69327778?
The InChIKey is AFQRNUWCAAQUBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO.BH2O2/c8-6-3-5-1-2-7(6)9-4-5;2-1-3/h1-3H,4H2;2-3H.
What are the key properties of CID 69327778?
CID 69327778 has a molecular weight of 168.94 g/mol, XLogP of 0.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69327778 is sourced from PubChem (CID 69327778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).