About 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid
2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid (PubChem CID 69328205) has the molecular formula C6H13N5O3
and a molecular weight of 203.20 g/mol. Its IUPAC name is 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid.
Molecular Properties
| Compound Name | 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid |
| PubChem CID | 69328205 |
| Molecular Formula | C6H13N5O3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N1C(C)=CCN1C |
| InChI | InChI=1S/C6H12N4.HNO3/c1-5-3-4-9(2)10(5)6(7)8;2-1(3)4/h3H,4H2,1-2H3,(H3,7,8);(H,2,3,4) |
| InChIKey | AZJXBPLHIHTXJF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid?
The IUPAC name of 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid (CID 69328205) is 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid.
What is the SMILES notation for 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid?
The canonical SMILES for 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid is O=[N+]([O-])O.[H]/N=C(\N)N1C(C)=CCN1C.
What is the InChIKey of 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid?
The InChIKey is AZJXBPLHIHTXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4.HNO3/c1-5-3-4-9(2)10(5)6(7)8;2-1(3)4/h3H,4H2,1-2H3,(H3,7,8);(H,2,3,4).
What are the key properties of 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid?
2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid has a molecular weight of 203.20 g/mol, XLogP of -0.40, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3H-pyrazole-1-carboximidamide;nitric acid is sourced from PubChem (CID 69328205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).