C22H20F3N5O3 — CID 69328222
3-[4-(tetrazol-2-yl)phenyl]spiro[chromene-2,4'-piperidine];2,2,2-trifluoroacetic acid (PubChem CID 69328222) has the molecular formula C22H20F3N5O3 and a molecular weight of 459.43 g/mol. Its IUPAC name is 3-[4-(tetrazol-2-yl)phenyl]spiro[chromene-2,4'-piperidine];2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-(tetrazol-2-yl)phenyl]spiro[chromene-2,4'-piperidine];2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69328222 |
| Molecular Formula | C22H20F3N5O3 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 3-[4-(tetrazol-2-yl)phenyl]spiro[chromene-2,4'-piperidine];2,2,2-trifluoroacetic acid |
| SMILES | C1=C(c2ccc(-n3ncnn3)cc2)C2(CCNCC2)Oc2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H19N5O.C2HF3O2/c1-2-4-19-16(3-1)13-18(20(26-19)9-11-21-12-10-20)15-5-7-17(8-6-15)25-23-14-22-24-25;3-2(4,5)1(6)7/h1-8,13-14,21H,9-12H2;(H,6,7) |
| InChIKey | LMTGKMFVMGYHAS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|