About 3-pentyl-2H-quinazoline
3-pentyl-2H-quinazoline (PubChem CID 69328254) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-pentyl-2H-quinazoline.
Molecular Properties
| Compound Name | 3-pentyl-2H-quinazoline |
| PubChem CID | 69328254 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-pentyl-2H-quinazoline |
| SMILES | CCCCCN1C=c2ccccc2=NC1 |
| InChI | InChI=1S/C13H18N2/c1-2-3-6-9-15-10-12-7-4-5-8-13(12)14-11-15/h4-5,7-8,10H,2-3,6,9,11H2,1H3 |
| InChIKey | NMTIIBZNJXRXGR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-2H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-2H-quinazoline?
The IUPAC name of 3-pentyl-2H-quinazoline (CID 69328254) is 3-pentyl-2H-quinazoline.
What is the SMILES notation for 3-pentyl-2H-quinazoline?
The canonical SMILES for 3-pentyl-2H-quinazoline is CCCCCN1C=c2ccccc2=NC1.
What is the InChIKey of 3-pentyl-2H-quinazoline?
The InChIKey is NMTIIBZNJXRXGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-2-3-6-9-15-10-12-7-4-5-8-13(12)14-11-15/h4-5,7-8,10H,2-3,6,9,11H2,1H3.
What are the key properties of 3-pentyl-2H-quinazoline?
3-pentyl-2H-quinazoline has a molecular weight of 202.30 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-2H-quinazoline is sourced from PubChem (CID 69328254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).