C23H37NO4 — CID 69329363
4,4-bis(4-hydroxypentyl)-3a-pentylisoindole-1,3-dione (PubChem CID 69329363) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is 4,4-bis(4-hydroxypentyl)-3a-pentylisoindole-1,3-dione.
| Compound Name | 4,4-bis(4-hydroxypentyl)-3a-pentylisoindole-1,3-dione |
|---|---|
| PubChem CID | 69329363 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 4,4-bis(4-hydroxypentyl)-3a-pentylisoindole-1,3-dione |
| SMILES | CCCCCC12C(=O)NC(=O)C1=CC=CC2(CCCC(C)O)CCCC(C)O |
| InChI | InChI=1S/C23H37NO4/c1-4-5-6-16-23-19(20(27)24-21(23)28)12-9-15-22(23,13-7-10-17(2)25)14-8-11-18(3)26/h9,12,15,17-18,25-26H,4-8,10-11,13-14,16H2,1-3H3,(H,24,27,28) |
| InChIKey | KSQXLLKXKZWSPI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|