About 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan
3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan (PubChem CID 69329401) has the molecular formula C19H19FO3S
and a molecular weight of 346.42 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan.
Molecular Properties
| Compound Name | 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan |
| PubChem CID | 69329401 |
| Molecular Formula | C19H19FO3S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan |
| SMILES | CC1(C)OCC(c2cccc(F)c2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19FO3S/c1-19(2)18(13-7-9-16(10-8-13)24(3,21)22)17(12-23-19)14-5-4-6-15(20)11-14/h4-11H,12H2,1-3H3 |
| InChIKey | ZPJRVKXQEXFTAZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan?
The IUPAC name of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan (CID 69329401) is 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan.
What is the SMILES notation for 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan?
The canonical SMILES for 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan is CC1(C)OCC(c2cccc(F)c2)=C1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan?
The InChIKey is ZPJRVKXQEXFTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FO3S/c1-19(2)18(13-7-9-16(10-8-13)24(3,21)22)17(12-23-19)14-5-4-6-15(20)11-14/h4-11H,12H2,1-3H3.
What are the key properties of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan?
3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan has a molecular weight of 346.42 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan is sourced from PubChem (CID 69329401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).