C27H35N5O7 — CID 69329627
tert-butyl N-[(E)-4-[2,6-dimethoxy-4-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]phenoxy]but-2-enyl]carbamate (PubChem CID 69329627) has the molecular formula C27H35N5O7 and a molecular weight of 541.61 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[2,6-dimethoxy-4-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]phenoxy]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[2,6-dimethoxy-4-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]phenoxy]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 69329627 |
| Molecular Formula | C27H35N5O7 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | tert-butyl N-[(E)-4-[2,6-dimethoxy-4-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]phenoxy]but-2-enyl]carbamate |
| SMILES | COc1cc(C=Cc2nc3c(c(=O)n(C)c(=O)n3C)n2C)cc(OC)c1OC/C=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35N5O7/c1-27(2,3)39-25(34)28-13-9-10-14-38-22-18(36-7)15-17(16-19(22)37-8)11-12-20-29-23-21(30(20)4)24(33)32(6)26(35)31(23)5/h9-12,15-16H,13-14H2,1-8H3,(H,28,34)/b10-9+,12-11? |
| InChIKey | IXODIILSAZBDLI-LYIXSAAJSA-N |
| XLogP | 2.62 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|