About triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane
triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane (PubChem CID 69329927) has the molecular formula C25H52O2Si2
and a molecular weight of 440.86 g/mol. Its IUPAC name is triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane |
| PubChem CID | 69329927 |
| Molecular Formula | C25H52O2Si2 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1CCC[C@@H]1O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H52O2Si2/c1-8-15-16-19-24(26-28(9-2,10-3)11-4)22-21-23-18-17-20-25(23)27-29(12-5,13-6)14-7/h21-25H,8-20H2,1-7H3/b22-21+/t23-,24-,25-/m0/s1 |
| InChIKey | QRHNTVYBKSHPGZ-VRHXENQKSA-N |
| XLogP | 8.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane?
The IUPAC name of triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane (CID 69329927) is triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane.
What is the SMILES notation for triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane?
The canonical SMILES for triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane is CCCCC[C@@H](/C=C/[C@@H]1CCC[C@@H]1O[Si](CC)(CC)CC)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane?
The InChIKey is QRHNTVYBKSHPGZ-VRHXENQKSA-N. The full InChI is InChI=1S/C25H52O2Si2/c1-8-15-16-19-24(26-28(9-2,10-3)11-4)22-21-23-18-17-20-25(23)27-29(12-5,13-6)14-7/h21-25H,8-20H2,1-7H3/b22-21+/t23-,24-,25-/m0/s1.
What are the key properties of triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane?
triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane has a molecular weight of 440.86 g/mol, XLogP of 8.70, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(E,3S)-1-[(1S,2S)-2-triethylsilyloxycyclopentyl]oct-1-en-3-yl]oxysilane is sourced from PubChem (CID 69329927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).