C29H29N7O7 — CID 69329938
2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-methoxymethyl]pyridine-3-carboxylic acid (PubChem CID 69329938) has the molecular formula C29H29N7O7 and a molecular weight of 587.59 g/mol. Its IUPAC name is 2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-methoxymethyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-methoxymethyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 69329938 |
| Molecular Formula | C29H29N7O7 |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-methoxymethyl]pyridine-3-carboxylic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(C(OC)c2ncccc2C(=O)O)[C@H]2O[C@@H](C=Cc3ccccc3)OC12 |
| InChI | InChI=1S/C29H29N7O7/c1-3-30-29(39)35-25-20-26(33-14-32-25)36(15-34-20)27-24-23(41-18(42-24)12-11-16-8-5-4-6-9-16)22(43-27)21(40-2)19-17(28(37)38)10-7-13-31-19/h4-15,18,21-24,27H,3H2,1-2H3,(H,37,38)(H2,30,32,33,35,39)/t18-,21?,22?,23-,24?,27?/m1/s1 |
| InChIKey | SCEMYOBSBCVAON-CQCZOLRTSA-N |
| XLogP | 3.17 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |