C9H7N3S5 — CID 69329995
3H-1,3-benzothiazole-2-thione;1,3,4-thiadiazolidine-2,5-dithione (PubChem CID 69329995) has the molecular formula C9H7N3S5 and a molecular weight of 317.51 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;1,3,4-thiadiazolidine-2,5-dithione.
| Compound Name | 3H-1,3-benzothiazole-2-thione;1,3,4-thiadiazolidine-2,5-dithione |
|---|---|
| PubChem CID | 69329995 |
| Molecular Formula | C9H7N3S5 |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;1,3,4-thiadiazolidine-2,5-dithione |
| SMILES | S=c1[nH][nH]c(=S)s1.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C2H2N2S3/c9-7-8-5-3-1-2-4-6(5)10-7;5-1-3-4-2(6)7-1/h1-4H,(H,8,9);(H,3,5)(H,4,6) |
| InChIKey | AUBHMLXIQPKKFG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|