C22H22N4O4S — CID 69330581
8-[(2,6-dioxo-3,4,5,7-tetrahydro-1H-1,7-benzodiazonin-8-yl)sulfanyl]-3,4,5,7-tetrahydro-1H-1,7-benzodiazonine-2,6-dione (PubChem CID 69330581) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 8-[(2,6-dioxo-3,4,5,7-tetrahydro-1H-1,7-benzodiazonin-8-yl)sulfanyl]-3,4,5,7-tetrahydro-1H-1,7-benzodiazonine-2,6-dione.
| Compound Name | 8-[(2,6-dioxo-3,4,5,7-tetrahydro-1H-1,7-benzodiazonin-8-yl)sulfanyl]-3,4,5,7-tetrahydro-1H-1,7-benzodiazonine-2,6-dione |
|---|---|
| PubChem CID | 69330581 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 8-[(2,6-dioxo-3,4,5,7-tetrahydro-1H-1,7-benzodiazonin-8-yl)sulfanyl]-3,4,5,7-tetrahydro-1H-1,7-benzodiazonine-2,6-dione |
| SMILES | O=C1CCCC(=O)Nc2c(cccc2Sc2cccc3c2NC(=O)CCCC(=O)N3)N1 |
| InChI | InChI=1S/C22H22N4O4S/c27-17-9-3-11-19(29)25-21-13(23-17)5-1-7-15(21)31-16-8-2-6-14-22(16)26-20(30)12-4-10-18(28)24-14/h1-2,5-8H,3-4,9-12H2,(H,23,27)(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | LSNWEVXBHMAAQH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |