C25H21Cl2N5O2 — CID 69330825
3-(3,4-dichlorophenyl)-2-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide (PubChem CID 69330825) has the molecular formula C25H21Cl2N5O2 and a molecular weight of 494.38 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-2-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69330825 |
| Molecular Formula | C25H21Cl2N5O2 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide |
| SMILES | COc1ccc2nccc(-n3cc4c(n3)CCC(C(=Cc3ccc(Cl)c(Cl)c3)C(N)=O)C4)c2n1 |
| InChI | InChI=1S/C25H21Cl2N5O2/c1-34-23-7-6-21-24(30-23)22(8-9-29-21)32-13-16-12-15(3-5-20(16)31-32)17(25(28)33)10-14-2-4-18(26)19(27)11-14/h2,4,6-11,13,15H,3,5,12H2,1H3,(H2,28,33) |
| InChIKey | LLFLYMCZSGFLSV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|