(2S)-3,4-dihydro-2H-chromene-2-carboxylic acid

C10H10O3 — CID 6933105

IUPAC(2S)-3,4-dihydro-2H-chromene-2-carboxylic acid
SMILESO=C(O)[C@@H]1CCc2ccccc2O1
InChIInChI=1S/C10H10O3/c11-10(12)9-6-5-7-3-1-2-4-8(7)13-9/h1-4,9H,5-6H2,(H,11,12)/t9-/m0/s1
InChIKeySFLFCQJQOIZMHF-VIFPVBQESA-N
MW178.19 g/mol
LogP1.46
Rot. Bonds1

About (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid

(2S)-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 6933105) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-3,4-dihydro-2H-chromene-2-carboxylic acid
PubChem CID6933105
Molecular FormulaC10H10O3
Molecular Weight178.19 g/mol
Exact Mass178.06
IUPAC Name(2S)-3,4-dihydro-2H-chromene-2-carboxylic acid
SMILESO=C(O)[C@@H]1CCc2ccccc2O1
InChIInChI=1S/C10H10O3/c11-10(12)9-6-5-7-3-1-2-4-8(7)13-9/h1-4,9H,5-6H2,(H,11,12)/t9-/m0/s1
InChIKeySFLFCQJQOIZMHF-VIFPVBQESA-N
XLogP1.46
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.19
LogP ≤ 51.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid?
The IUPAC name of (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid (CID 6933105) is (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid.
What is the SMILES notation for (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid?
The canonical SMILES for (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid is O=C(O)[C@@H]1CCc2ccccc2O1.
What is the InChIKey of (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid?
The InChIKey is SFLFCQJQOIZMHF-VIFPVBQESA-N. The full InChI is InChI=1S/C10H10O3/c11-10(12)9-6-5-7-3-1-2-4-8(7)13-9/h1-4,9H,5-6H2,(H,11,12)/t9-/m0/s1.
What are the key properties of (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid?
(2S)-3,4-dihydro-2H-chromene-2-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,4-dihydro-2H-chromene-2-carboxylic acid is sourced from PubChem (CID 6933105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).