About 5-hexoxypyrazolo[1,5-a]pyrimidine
5-hexoxypyrazolo[1,5-a]pyrimidine (PubChem CID 69331126) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-hexoxypyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 5-hexoxypyrazolo[1,5-a]pyrimidine |
| PubChem CID | 69331126 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-hexoxypyrazolo[1,5-a]pyrimidine |
| SMILES | CCCCCCOc1ccn2nccc2n1 |
| InChI | InChI=1S/C12H17N3O/c1-2-3-4-5-10-16-12-7-9-15-11(14-12)6-8-13-15/h6-9H,2-5,10H2,1H3 |
| InChIKey | CQPRFGVZEBRNOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexoxypyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexoxypyrazolo[1,5-a]pyrimidine?
The IUPAC name of 5-hexoxypyrazolo[1,5-a]pyrimidine (CID 69331126) is 5-hexoxypyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5-hexoxypyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5-hexoxypyrazolo[1,5-a]pyrimidine is CCCCCCOc1ccn2nccc2n1.
What is the InChIKey of 5-hexoxypyrazolo[1,5-a]pyrimidine?
The InChIKey is CQPRFGVZEBRNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-2-3-4-5-10-16-12-7-9-15-11(14-12)6-8-13-15/h6-9H,2-5,10H2,1H3.
What are the key properties of 5-hexoxypyrazolo[1,5-a]pyrimidine?
5-hexoxypyrazolo[1,5-a]pyrimidine has a molecular weight of 219.29 g/mol, XLogP of 2.69, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexoxypyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 69331126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).