About ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate
ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate (PubChem CID 69331159) has the molecular formula C15H26O8
and a molecular weight of 334.37 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate |
| PubChem CID | 69331159 |
| Molecular Formula | C15H26O8 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate |
| SMILES | CCOC(=O)C(C)(O)C1CCC(=O)O1.COCC(C)OC(C)=O |
| InChI | InChI=1S/C9H14O5.C6H12O3/c1-3-13-8(11)9(2,12)6-4-5-7(10)14-6;1-5(4-8-3)9-6(2)7/h6,12H,3-5H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | GKRQTOLLSANVLU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate?
The IUPAC name of ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate (CID 69331159) is ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate.
What is the SMILES notation for ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate?
The canonical SMILES for ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate is CCOC(=O)C(C)(O)C1CCC(=O)O1.COCC(C)OC(C)=O.
What is the InChIKey of ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate?
The InChIKey is GKRQTOLLSANVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5.C6H12O3/c1-3-13-8(11)9(2,12)6-4-5-7(10)14-6;1-5(4-8-3)9-6(2)7/h6,12H,3-5H2,1-2H3;5H,4H2,1-3H3.
What are the key properties of ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate?
ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate has a molecular weight of 334.37 g/mol, XLogP of 0.59, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-2-(5-oxooxolan-2-yl)propanoate;1-methoxypropan-2-yl acetate is sourced from PubChem (CID 69331159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).